Introduction:Basic information about CAS 350047-72-2|Cyclohexyl 4-hydroxy-7-methoxy-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Cyclohexyl 4-hydroxy-7-methoxy-2-naphthoate |
|---|
| CAS Number | 350047-72-2 | Molecular Weight | 300.34900 |
|---|
| Density | 1.23g/cm3 | Boiling Point | 496.3ºC at 760 mmHg |
|---|
| Molecular Formula | C18H20O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 181.2ºC |
|---|
Names
| Name | Cyclohexyl 4-hydroxy-7-methoxy-2-naphthoate |
|---|
Chemical & Physical Properties
| Density | 1.23g/cm3 |
|---|
| Boiling Point | 496.3ºC at 760 mmHg |
|---|
| Molecular Formula | C18H20O4 |
|---|
| Molecular Weight | 300.34900 |
|---|
| Flash Point | 181.2ºC |
|---|
| Exact Mass | 300.13600 |
|---|
| PSA | 55.76000 |
|---|
| LogP | 4.04350 |
|---|
| Index of Refraction | 1.612 |
|---|
| InChIKey | YLDSGUQUOBPSLE-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc2c(O)cc(C(=O)OC3CCCCC3)cc2c1 |
|---|