Introduction：Basic information about CAS 464171-71-9|Ethyl 5,8-dimethoxy-4-(methoxymethoxy)-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl 5,8-dimethoxy-4-(methoxymethoxy)-2-naphthoate |
|---|
| CAS Number | 464171-71-9 | Molecular Weight | 320.33700 |
|---|
| Density | 1.174g/cm3 | Boiling Point | 471ºC at 760 mmHg |
|---|
| Molecular Formula | C17H20O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 208.1ºC |
|---|
Names
| Name | Ethyl 5,8-dimethoxy-4-(methoxymethoxy)-2-naphthoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.174g/cm3 |
|---|
| Boiling Point | 471ºC at 760 mmHg |
|---|
| Molecular Formula | C17H20O6 |
|---|
| Molecular Weight | 320.33700 |
|---|
| Flash Point | 208.1ºC |
|---|
| Exact Mass | 320.12600 |
|---|
| PSA | 63.22000 |
|---|
| LogP | 3.01640 |
|---|
| Index of Refraction | 1.55 |
|---|
| InChIKey | PAPMOZHTLBPJGC-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cc(OCOC)c2c(OC)ccc(OC)c2c1 |
|---|
Synonyms
| Ethyl 5,8-difluoro-1,4-dihydro-4-oxoquinoline-3-carboxylate |
| ethyl 5,8-dimethoxy-4-methoxymethoxy-2-naphthoate |
| ethyl 5,8-difluoro-4-oxo-1,4-dihydroquinoline-3-carboxylate |
