Introduction：Basic information about CAS 500777-04-8|Ethyl 4-(benzyloxy)-5,8-dimethoxy-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl 4-(benzyloxy)-5,8-dimethoxy-2-naphthoate |
|---|
| CAS Number | 500777-04-8 | Molecular Weight | 366.40700 |
|---|
| Density | 1.179g/cm3 | Boiling Point | 532.053ºC at 760 mmHg |
|---|
| Molecular Formula | C22H22O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 232.412ºC |
|---|
Names
| Name | Ethyl 4-(benzyloxy)-5,8-dimethoxy-2-naphthoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.179g/cm3 |
|---|
| Boiling Point | 532.053ºC at 760 mmHg |
|---|
| Molecular Formula | C22H22O5 |
|---|
| Molecular Weight | 366.40700 |
|---|
| Flash Point | 232.412ºC |
|---|
| Exact Mass | 366.14700 |
|---|
| PSA | 53.99000 |
|---|
| LogP | 4.61270 |
|---|
| Index of Refraction | 1.591 |
|---|
| InChIKey | XCASSKXAVDMPQF-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cc(OCc2ccccc2)c2c(OC)ccc(OC)c2c1 |
|---|
Synonyms
| ethyl 4-benzyloxy-5,8-dimethoxy-2-naphthoate |
| 4-benzyloxyacetoacetic ethyl ester |
| 4-benzyloxy-3-oxo-butyric acid ethyl ester |
| ethyl 4-benzyloxyacetoacetate |
| ethyl 4-benzyloxy-3-oxobutyrate |
