Introduction：Basic information about CAS 740836-59-3|Methyl 7-(benzyloxy)-8-bromo-4-hydroxy-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 7-(benzyloxy)-8-bromo-4-hydroxy-2-naphthoate |
|---|
| CAS Number | 740836-59-3 | Molecular Weight | 387.22400 |
|---|
| Density | 1.484g/cm3 | Boiling Point | 558ºC at 760 mmHg |
|---|
| Molecular Formula | C19H15BrO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 291.3ºC |
|---|
Names
| Name | Methyl 7-(benzyloxy)-8-bromo-4-hydroxy-2-naphthoate |
|---|
Chemical & Physical Properties
| Density | 1.484g/cm3 |
|---|
| Boiling Point | 558ºC at 760 mmHg |
|---|
| Molecular Formula | C19H15BrO4 |
|---|
| Molecular Weight | 387.22400 |
|---|
| Flash Point | 291.3ºC |
|---|
| Exact Mass | 386.01500 |
|---|
| PSA | 55.76000 |
|---|
| LogP | 4.67350 |
|---|
| Index of Refraction | 1.662 |
|---|
| InChIKey | NLSQXLVYGGIPRR-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(O)c2ccc(OCc3ccccc3)c(Br)c2c1 |
|---|
