Introduction：Basic information about CAS 861073-71-4|7-Amino-8-chloro-4-hydroxy-2-naphthoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 7-Amino-8-chloro-4-hydroxy-2-naphthoic acid |
|---|
| CAS Number | 861073-71-4 | Molecular Weight | 237.63900 |
|---|
| Density | 1.597g/cm3 | Boiling Point | 502.9ºC at 760 mmHg |
|---|
| Molecular Formula | C11H8ClNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 257.9ºC |
|---|
Names
| Name | 7-Amino-8-chloro-4-hydroxy-2-naphthoic acid |
|---|
Chemical & Physical Properties
| Density | 1.597g/cm3 |
|---|
| Boiling Point | 502.9ºC at 760 mmHg |
|---|
| Molecular Formula | C11H8ClNO3 |
|---|
| Molecular Weight | 237.63900 |
|---|
| Flash Point | 257.9ºC |
|---|
| Exact Mass | 237.01900 |
|---|
| PSA | 83.55000 |
|---|
| LogP | 3.06040 |
|---|
| Index of Refraction | 1.773 |
|---|
| InChIKey | PRASGWWSYSGDPK-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc2c(O)cc(C(=O)O)cc2c1Cl |
|---|
