Introduction：Basic information about CAS 859921-58-7|4-[(Ethoxycarbonyl)oxy]-2-naphthoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-[(Ethoxycarbonyl)oxy]-2-naphthoic acid |
|---|
| CAS Number | 859921-58-7 | Molecular Weight | 260.24200 |
|---|
| Density | 1.323g/cm3 | Boiling Point | 437.5ºC at 760 mmHg |
|---|
| Molecular Formula | C14H12O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 167.3ºC |
|---|
Names
| Name | 4-[(Ethoxycarbonyl)oxy]-2-naphthoic acid |
|---|
Chemical & Physical Properties
| Density | 1.323g/cm3 |
|---|
| Boiling Point | 437.5ºC at 760 mmHg |
|---|
| Molecular Formula | C14H12O5 |
|---|
| Molecular Weight | 260.24200 |
|---|
| Flash Point | 167.3ºC |
|---|
| Exact Mass | 260.06800 |
|---|
| PSA | 72.83000 |
|---|
| LogP | 3.07330 |
|---|
| Index of Refraction | 1.616 |
|---|
| InChIKey | JAZXGVCNHXLSSY-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)Oc1cc(C(=O)O)cc2ccccc12 |
|---|
