Introduction：Basic information about CAS 21722-85-0|inezin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | inezin |
|---|
| CAS Number | 21722-85-0 | Molecular Weight | 292.33300 |
|---|
| Density | 1.19g/cm3 | Boiling Point | 406.1ºC at 760 mmHg |
|---|
| Molecular Formula | C15H17O2PS | Melting Point | / |
|---|
| MSDS | / | Flash Point | 199.4ºC |
|---|
Names
| Name | inezin |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.19g/cm3 |
|---|
| Boiling Point | 406.1ºC at 760 mmHg |
|---|
| Molecular Formula | C15H17O2PS |
|---|
| Molecular Weight | 292.33300 |
|---|
| Flash Point | 199.4ºC |
|---|
| Exact Mass | 292.06900 |
|---|
| PSA | 61.41000 |
|---|
| LogP | 4.47490 |
|---|
| Vapour Pressure | 1.96E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.58 |
|---|
| InChIKey | PBOOGLULPGUHFZ-UHFFFAOYSA-N |
|---|
| SMILES | CCOP(=O)(SCc1ccccc1)c1ccccc1 |
|---|
Safety Information
Customs
| HS Code | 2930909090 |
|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| O-ethyl S-(phenylmethyl) P-phenylphosphonothioate |
| ESBP |
| Phenylphosphonothioic acid O-ethyl S-(phenylmethyl) ester |
| Phosphonothioic acid,phenyl-,O-ethyl S-(phenylmethyl) ester |
| (RS)-(S-benzyl O-ethyl phenylphosphonothioate) |
| Phosphonothioic acid,phenyl-,S-benzyl O-ethyl ester |
| (Ξ)-(S-benzyl O-ethyl phenylphosphonothioate) |
| INEZIN |
| [ethoxy(phenyl)phosphoryl]sulfanylmethylbenzene |
| UNII-139T2EY20M |
| phenylphosphonothioic acid S-benzyl ester O-ethyl ester |
