Introduction：Basic information about CAS 51934-76-0|IomorinicAcid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | IomorinicAcid |
|---|
| CAS Number | 51934-76-0 | Molecular Weight | 711.07200 |
|---|
| Density | 2.23g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C17H20I3N3O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-Methyl-3-[(2,4,6-triiodo-3-{(E)-[1-(4-morpholinyl)ethylidene]am ino}benzoyl)amino]propanoic acid |
|---|
Chemical & Physical Properties
| Density | 2.23g/cm3 |
|---|
| Molecular Formula | C17H20I3N3O4 |
|---|
| Molecular Weight | 711.07200 |
|---|
| Exact Mass | 710.85900 |
|---|
| PSA | 94.72000 |
|---|
| LogP | 3.84570 |
|---|
| Index of Refraction | 1.731 |
|---|
| InChIKey | OUMSIYHSIIRHKR-UHFFFAOYSA-N |
|---|
| SMILES | CC(=Nc1c(I)cc(I)c(C(=O)NCC(C)C(=O)O)c1I)N1CCOCC1 |
|---|
