Introduction：Basic information about CAS 56562-79-9|Ioglunide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ioglunide |
|---|
| CAS Number | 56562-79-9 | Molecular Weight | 807.11100 |
|---|
| Density | 2.307g/cm3 | Boiling Point | 1048.3ºC at 760mmHg |
|---|
| Molecular Formula | C18H24I3N3O9 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 587.8ºC |
|---|
Names
| Name | Remerine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.307g/cm3 |
|---|
| Boiling Point | 1048.3ºC at 760mmHg |
|---|
| Molecular Formula | C18H24I3N3O9 |
|---|
| Molecular Weight | 807.11100 |
|---|
| Flash Point | 587.8ºC |
|---|
| Exact Mass | 806.86500 |
|---|
| PSA | 206.87000 |
|---|
| Index of Refraction | 1.76 |
|---|
| InChIKey | ODYPLCHSCOJEIZ-GMYJMXFCSA-N |
|---|
| SMILES | CC(=O)N(C)c1c(I)c(NC(=O)C(O)C(O)C(O)C(O)CO)c(I)c(C(=O)NCCO)c1I |
|---|
Synonyms
| l-Roemerine |
| (7ar)-7-methyl-6,7,7a,8-tetrahydro-5h-[1,3]benzodioxolo[6,5,4-de]benzo[g]quinoline |
| (-)-Aporheine |
| Roemerin |
| Roemerine |
| Remerin |
