Introduction:Basic information about CAS 17417-09-3|2-Fluoro-5-nitrobenzonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Fluoro-5-nitrobenzonitrile |
|---|
| CAS Number | 17417-09-3 | Molecular Weight | 166.10900 |
|---|
| Density | 1.41g/cm3 | Boiling Point | 94 °C / 0.5mmHg |
|---|
| Molecular Formula | C7H3FN2O2 | Melting Point | 76-80 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 111.4ºC |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 2-Fluoro-5-nitrobenzonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.41g/cm3 |
|---|
| Boiling Point | 94 °C / 0.5mmHg |
|---|
| Melting Point | 76-80 °C(lit.) |
|---|
| Molecular Formula | C7H3FN2O2 |
|---|
| Molecular Weight | 166.10900 |
|---|
| Flash Point | 111.4ºC |
|---|
| Exact Mass | 166.01800 |
|---|
| PSA | 69.61000 |
|---|
| LogP | 2.12878 |
|---|
| Vapour Pressure | 0.0608mmHg at 25°C |
|---|
| Index of Refraction | 1.503 |
|---|
| InChIKey | YLACBMHBZVYOAP-UHFFFAOYSA-N |
|---|
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1F |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H312-H315-H319-H332-H335 |
|---|
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xn:Harmful; |
|---|
| Risk Phrases | R20/21/22;R36/37/38 |
|---|
| Safety Phrases | S26-S36-S36/37/39 |
|---|
| RIDADR | 3439 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 6.1 |
|---|
| HS Code | 2926909090 |
|---|
Customs
| HS Code | 2926909090 |
|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| MFCD00042299 |
| 2-Fluoro-5-Nitrobenzonitrile |
| 3-Cyano-4-fluoro-1-nitrobenzene |
| 2-fluoro-5-nitro-benzonitrile |
| 2-Fluoro-5-nitrobenzenenitrile |
| 3-Cyano-4-fluoronitrobenzene |
| 2-fluoro-5-nitro-bezonitrile |