Introduction：Basic information about CAS 70516-41-5|UNII:Z9ZL7M98QS, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | UNII:Z9ZL7M98QS |
|---|
| CAS Number | 70516-41-5 | Molecular Weight | 518.645 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 692.2±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C34H34N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 372.4±31.5 °C |
|---|
Names
| Name | 2'-anilino-6'-[ethyl(3-methylbutyl)amino]-3'-methylspiro[isobenzofuran-1(3H),9'-[9H]xanthene]-3-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 692.2±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C34H34N2O3 |
|---|
| Molecular Weight | 518.645 |
|---|
| Flash Point | 372.4±31.5 °C |
|---|
| Exact Mass | 518.256958 |
|---|
| PSA | 50.80000 |
|---|
| LogP | 8.08 |
|---|
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.667 |
|---|
| InChIKey | HUSIBQLZEMMTCQ-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CCC(C)C)c1ccc2c(c1)Oc1cc(C)c(Nc3ccccc3)cc1C21OC(=O)c2ccccc21 |
|---|
Synonyms
| 2'-Anilino-6'-(ethyl(3-methylbutyl)amino)-3'-methylspiro(isobenzofuran-1(3H),9'-(9H)xanthene)-3-one |
| 3-N-Isoamyl-N-ethylamino-6-methyl-7-anilinofluoran |
| Spiro(isobenzofuran-1(3H),9'-(9H)xanthen)-3-one, 6'-(ethyl(3-methylbutyl)amino)-3'-methyl-2'-(phenylamino)- |
| S-205 |
| 2'-Anilino-6'-[ethyl(3-methylbutyl)amino]-3'-methyl-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one |
| Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 6'-[ethyl(3-methylbutyl)amino]-3'-methyl-2'-(phenylamino)- |
| UNII:Z9ZL7M98QS |
