Introduction:Basic information about CAS 89331-94-2|2-Anilino-6-dibutylamino-3-methylfluoran, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Anilino-6-dibutylamino-3-methylfluoran |
|---|
| CAS Number | 89331-94-2 | Molecular Weight | 532.672 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 704.5±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C35H36N2O3 | Melting Point | 179-184ºC |
|---|
| MSDS | / | Flash Point | 379.8±32.9 °C |
|---|
Names
| Name | 2-Anilino-6-dibutylamino-3-methylfluoran |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 704.5±60.0 °C at 760 mmHg |
|---|
| Melting Point | 179-184ºC |
|---|
| Molecular Formula | C35H36N2O3 |
|---|
| Molecular Weight | 532.672 |
|---|
| Flash Point | 379.8±32.9 °C |
|---|
| Exact Mass | 532.272583 |
|---|
| PSA | 50.80000 |
|---|
| LogP | 8.80 |
|---|
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.661 |
|---|
| InChIKey | XAAILNNJDMIMON-UHFFFAOYSA-N |
|---|
| SMILES | CCCCN(CCCC)c1ccc2c(c1)Oc1cc(C)c(Nc3ccccc3)cc1C21OC(=O)c2ccccc21 |
|---|
Safety Information
| Risk Phrases | R52/53 |
|---|
| Safety Phrases | 61 |
|---|
Synonyms
| MFCD00307579 |
| 6'-(dibutylamino)-3'-methyl-2'-(phenylamino)-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one |
| T C666 BO IXJ E1 FMR& MN4&4 I-& DT56 BVOXJ |
| Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 6'-(dibutylamino)-3'-methyl-2'-(phenylamino)- |
| 2-Phenylamino-3-methyl-6-di-n-butylaminofluoran 3-Di-n-butylamino-6-methyl-7-phenylaminofluoran odb-two |
| 6'-(Dibutylamino)-3'-methyl-2'-(phenylamino)-3H-spiro[2-benzofuran-1,9'-xanthen]-3-on |
| Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one-6'-(dibutylamino)-3'-methyl-2'-(phenylamino)- |
| 2'-Anilino-6'-(dibutylamino)-3'-methyl-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one |
| EINECS 403-830-5 |
| UNII:2H1E1033W1 |
| 2'-anilino-6'-(dibutylamino)-3'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one |
| 2-phenylamino-3-methyl-6-dibutylaminofluorane |