Introduction：Basic information about CAS 29887-08-9|Solvent Blue 58, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Solvent Blue 58 |
|---|
| CAS Number | 29887-08-9 | Molecular Weight | 462.66700 |
|---|
| Density | 1.076g/cm3 | Boiling Point | 632ºC at 760mmHg |
|---|
| Molecular Formula | C30H42N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 154.9ºC |
|---|
Names
| Name | 1,4-bis(2-ethylhexylamino)anthracene-9,10-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.076g/cm3 |
|---|
| Boiling Point | 632ºC at 760mmHg |
|---|
| Molecular Formula | C30H42N2O2 |
|---|
| Molecular Weight | 462.66700 |
|---|
| Flash Point | 154.9ºC |
|---|
| Exact Mass | 462.32500 |
|---|
| PSA | 58.20000 |
|---|
| LogP | 7.86460 |
|---|
| Vapour Pressure | 7.04E-16mmHg at 25°C |
|---|
| Index of Refraction | 1.578 |
|---|
| InChIKey | ULYAQFDBACQQGC-UHFFFAOYSA-N |
|---|
| SMILES | CCCCC(CC)CNc1ccc(NCC(CC)CCCC)c2c1C(=O)c1ccccc1C2=O |
|---|
Synonyms
| 1,4-Bis((2-ethylhexyl)amino)anthraquinone |
| ap blue 58 |
| EINECS 249-931-6 |
| Solvent Blue 58 |
