Introduction：Basic information about CAS 23912-79-0|5,7,12,14-Pentacenetetrone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5,7,12,14-Pentacenetetrone |
|---|
| CAS Number | 23912-79-0 | Molecular Weight | 338.312 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 597.4±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C22H10O4 | Melting Point | 400ºC |
|---|
| MSDS | / | Flash Point | 266.3±15.7 °C |
|---|
Names
| Name | pentacene-5,7,12,14-tetrone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 597.4±50.0 °C at 760 mmHg |
|---|
| Melting Point | 400ºC |
|---|
| Molecular Formula | C22H10O4 |
|---|
| Molecular Weight | 338.312 |
|---|
| Flash Point | 266.3±15.7 °C |
|---|
| Exact Mass | 338.057922 |
|---|
| PSA | 68.28000 |
|---|
| LogP | 4.55 |
|---|
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.728 |
|---|
| InChIKey | YZOGOBWHTVNKGA-UHFFFAOYSA-N |
|---|
| SMILES | O=c1c2ccccc2c(=O)c2cc3c(=O)c4ccccc4c(=O)c3cc12 |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| HS Code | 2914190090 |
|---|
Customs
| HS Code | 2914190090 |
|---|
| Summary | 2914190090 other acyclic ketones without other oxygen function。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| Pentacene-5,7,12,14-tetrone |
| (Naphtho-2'.3':2.3-anthracen)-dichinon-(9.10,1'.4') |
| Pentacendichinon-(5.14,7.12) |
| 5,14:7,12-pentacenediquinone |
| Pentacen-5,7,12,14-tetraon |
| 5,7,12,14-Pentacenetetrone |
| pentacene-5,7,12,14-tetraone |
| 5,7,12,14-pentacenetetraone |
