Introduction：Basic information about CAS 15518-84-0|phenacyl 2-morpholin-4-ylacetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | phenacyl 2-morpholin-4-ylacetate |
|---|
| CAS Number | 15518-84-0 | Molecular Weight | 263.28900 |
|---|
| Density | 1.185g/cm3 | Boiling Point | 401.2ºC at 760mmHg |
|---|
| Molecular Formula | C14H17NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 196.4ºC |
|---|
Names
| Name | phenacyl 2-morpholin-4-ylacetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.185g/cm3 |
|---|
| Boiling Point | 401.2ºC at 760mmHg |
|---|
| Molecular Formula | C14H17NO4 |
|---|
| Molecular Weight | 263.28900 |
|---|
| Flash Point | 196.4ºC |
|---|
| Exact Mass | 263.11600 |
|---|
| PSA | 55.84000 |
|---|
| LogP | 0.68260 |
|---|
| Vapour Pressure | 1.2E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.533 |
|---|
| InChIKey | WIELTBTVQBNULW-UHFFFAOYSA-N |
|---|
| SMILES | O=C(CN1CCOCC1)OCC(=O)c1ccccc1 |
|---|
Safety Information
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| MOBECARB |
| Mobecarbo [INN-Spanish] |
| Mobecarbum [INN-Latin] |
| Mobecarbum |
| Benzoylmethylmorpholinoacetat |
| morpholin-4-yl-acetic acid 2-oxo-2-phenyl-ethyl ester |
| Mobecarbe |
| Mobecarbe [INN-French] |
| Benzoylcarbinaol-morpholinoacetat |
| Morpholinoessigsaeure-benzoylmethylester |
| Mobecarbo |
