Introduction：Basic information about CAS 60031-08-5|3-Oxo-2,3-dihydro-1H-indene-5-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Oxo-2,3-dihydro-1H-indene-5-carboxylic acid |
|---|
| CAS Number | 60031-08-5 | Molecular Weight | 176.169 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 375.2±31.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H8O3 | Melting Point | 256-260ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 194.9±21.3 °C |
|---|
| Symbol |
GHS06 | Signal Word | Danger |
|---|
Names
| Name | 3-oxo-1,2-dihydroindene-5-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 375.2±31.0 °C at 760 mmHg |
|---|
| Melting Point | 256-260ºC |
|---|
| Molecular Formula | C10H8O3 |
|---|
| Molecular Weight | 176.169 |
|---|
| Flash Point | 194.9±21.3 °C |
|---|
| Exact Mass | 176.047348 |
|---|
| PSA | 54.37000 |
|---|
| LogP | 2.00 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.632 |
|---|
| InChIKey | BIABIACQHKYEEB-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccc2c(c1)C(=O)CC2 |
|---|
Safety Information
| Symbol |
GHS06 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H301-H315-H319-H335 |
|---|
| Precautionary Statements | P261-P301 + P310-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
|---|
| Hazard Codes | T |
|---|
| Risk Phrases | 25-36/37/38 |
|---|
| Safety Phrases | 26-36/37/39-45 |
|---|
| RIDADR | UN 2811 6.1/PG 3 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2918300090 |
|---|
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| indanone-6-carboxylic acid |
| 3-Oxo-indan-5-carbonsaeure |
| 2,3-Dihydro-3-oxo-1H-indene-5-carboxylic acid |
| 6-carboxy-1-indanone |
| 3-Oxo-indan-5-carboxylic acid |
| indanone-6-carboxilic acid |
| 1H-Indene-5-carboxylic acid, 2,3-dihydro-3-oxo- |
| MFCD02179295 |
| 3-oxoindane-5-carboxylic acid |
| 1-Indanone-6-carboxylic acid |
| 3-Oxo-5-indanecarboxylic acid |
| Indan-1-one-6-carboxylic acid |
