Introduction：Basic information about CAS 94512-73-9|2-BROMO-1-(4'-BROMO-[1,1'-BIPHENYL]-4-YL)ETHANONE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-BROMO-1-(4'-BROMO-[1,1'-BIPHENYL]-4-YL)ETHANONE |
|---|
| CAS Number | 94512-73-9 | Molecular Weight | 354.03700 |
|---|
| Density | 1.642g/cm3 | Boiling Point | 413.5ºC at 760mmHg |
|---|
| Molecular Formula | C14H10Br2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 118.6ºC |
|---|
Names
| Name | 2-bromo-1-[4-(4-bromophenyl)phenyl]ethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.642g/cm3 |
|---|
| Boiling Point | 413.5ºC at 760mmHg |
|---|
| Molecular Formula | C14H10Br2O |
|---|
| Molecular Weight | 354.03700 |
|---|
| Flash Point | 118.6ºC |
|---|
| Exact Mass | 351.91000 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 4.69370 |
|---|
| Index of Refraction | 1.625 |
|---|
| InChIKey | MHUAWTIXPZEHRL-UHFFFAOYSA-N |
|---|
| SMILES | O=C(CBr)c1ccc(-c2ccc(Br)cc2)cc1 |
|---|
Synonyms
| 2-bromo-1-(4'-bromo-biphenyl-4-yl)-ethanone |
| 2-Bromo-1-(4''-Bromo-1,1''-Biphenyl-4-Yl)Ethanone |
| 1-(2-bromoethanone)-4-(4-bromophenyl)-benzene |
| 4-(4'-bromophenyl)bromoacetophenone |
