Introduction：Basic information about CAS 50903-75-8|Z-Ala-Ile-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Z-Ala-Ile-OH |
|---|
| CAS Number | 50903-75-8 | Molecular Weight | 336.38300 |
|---|
| Density | 1.181g/cm3 | Boiling Point | 581.7ºC at 760mmHg |
|---|
| Molecular Formula | C17H24N2O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 305.6ºC |
|---|
Names
| Name | 3-methyl-2-[2-(phenylmethoxycarbonylamino)propanoylamino]pentanoic acid |
|---|
Chemical & Physical Properties
| Density | 1.181g/cm3 |
|---|
| Boiling Point | 581.7ºC at 760mmHg |
|---|
| Molecular Formula | C17H24N2O5 |
|---|
| Molecular Weight | 336.38300 |
|---|
| Flash Point | 305.6ºC |
|---|
| Exact Mass | 336.16900 |
|---|
| PSA | 104.73000 |
|---|
| LogP | 2.69860 |
|---|
| Index of Refraction | 1.529 |
|---|
| InChIKey | RKKAECASDDATIR-UHFFFAOYSA-N |
|---|
| SMILES | CCC(C)C(NC(=O)C(C)NC(=O)OCc1ccccc1)C(=O)O |
|---|
