Introduction：Basic information about CAS 375-48-4|1-bromononafluorobutane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-bromononafluorobutane |
|---|
| CAS Number | 375-48-4 | Molecular Weight | 298.93200 |
|---|
| Density | 1.904g/cm3 | Boiling Point | 43-44°C |
|---|
| Molecular Formula | C4BrF9 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1-bromo-1,1,2,2,3,3,4,4,4-nonafluorobutane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.904g/cm3 |
|---|
| Boiling Point | 43-44°C |
|---|
| Molecular Formula | C4BrF9 |
|---|
| Molecular Weight | 298.93200 |
|---|
| Exact Mass | 297.90400 |
|---|
| LogP | 3.80700 |
|---|
| InChIKey | CVEIKEYTQKDDQK-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)Br |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| HS Code | 2903799090 |
|---|
Customs
| HS Code | 2903799090 |
|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 1-Brom-nonafluor-butan |
| MFCD00082622 |
| 1-bromo-1,1,2,2,3,3,4,4,4-nonafluoro-butane |
| PC5309 |
| nonafluorobutyl bromide |
| Perfluor-1-brombutan |
| Nonafluoro-1-bromobutane |
| perfluorobutyl bromide |
| 1-bromononafluorobutane |
