Introduction：Basic information about CAS 24273-19-6|Butanoic acid 2,4-dinitrophenyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Butanoic acid 2,4-dinitrophenyl ester |
|---|
| CAS Number | 24273-19-6 | Molecular Weight | 254.19600 |
|---|
| Density | 1.383g/cm3 | Boiling Point | 386.1ºC at 760mmHg |
|---|
| Molecular Formula | C10H10N2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 175.6ºC |
|---|
Names
| Name | (2,4-dinitrophenyl) butanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.383g/cm3 |
|---|
| Boiling Point | 386.1ºC at 760mmHg |
|---|
| Molecular Formula | C10H10N2O6 |
|---|
| Molecular Weight | 254.19600 |
|---|
| Flash Point | 175.6ºC |
|---|
| Exact Mass | 254.05400 |
|---|
| PSA | 117.94000 |
|---|
| LogP | 3.25490 |
|---|
| Vapour Pressure | 3.62E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.566 |
|---|
| InChIKey | SBVYGYGWGWKSIL-UHFFFAOYSA-N |
|---|
| SMILES | CCCC(=O)Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
|---|
| Storage condition | 2-8°C |
|---|
Synonyms
| 2,4-dinitrophenyl butanoate |
| Butanoic acid,4-dinitrophenyl ester |
| Butyric acid,4-dinitrophenyl ester |
| Buttersaeure-(2,4-dinitro-phenylester) |
| 2,4-Dinitrophenylbutanoat |
| 2,4-Dinitro-1-butyryloxy-benzol |
| 2,4-Dinitrophenyl butyrate |
| 2,4-dinitrophenyl butyrate |
| butyric acid-(2,4-dinitro-phenyl ester) |
| 2,4-Dinitrophenylbutyrat |
