Introduction：Basic information about CAS 10553-13-6|6-Nitro-1H-indole-3-carbaldehyde, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Nitro-1H-indole-3-carbaldehyde |
|---|
| CAS Number | 10553-13-6 | Molecular Weight | 190.156 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 441.5±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H6N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 220.8±23.2 °C |
|---|
Names
| Name | 6-Nitro-1H-indole-3-carbaldehyde |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 441.5±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H6N2O3 |
|---|
| Molecular Weight | 190.156 |
|---|
| Flash Point | 220.8±23.2 °C |
|---|
| Exact Mass | 190.037842 |
|---|
| PSA | 78.68000 |
|---|
| LogP | 1.41 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.765 |
|---|
| InChIKey | KYFZSGBVGJNEPN-UHFFFAOYSA-N |
|---|
| SMILES | O=Cc1c[nH]c2cc([N+](=O)[O-])ccc12 |
|---|
Synonyms
| 1H-Indole-3-carboxaldehyde,6-nitro |
| 6-nitro-3-indolaldehyde |
| 6-Nitro-1H-indole-3-carbaldehyde |
| 6-nitro-1H-indole-3-carboxaldehyde |
| 1H-Indole-3-carboxaldehyde, 6-nitro- |
| 6-nitroindole-3-carbaldehyde |
| 6-nitroindole-3-carboxaldehyde |
| 6-nitro-3-indolecarbaldehyde |
| 6-nitroindol-3-carboxaldehyde |
