Introduction:Basic information about CAS 1066-77-9|tetrakis(dimethylamino)tin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tetrakis(dimethylamino)tin |
|---|
| CAS Number | 1066-77-9 | Molecular Weight | 295.00400 |
|---|
| Density | 1.17 | Boiling Point | 53-55ºC(0.1mmHg) |
|---|
| Molecular Formula | C8H24N4Sn | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | -8ºC |
|---|
| Symbol | GHS02, GHS05, GHS07 | Signal Word | Danger |
|---|
Names
| Name | N-methyl-N-[tris(dimethylamino)stannyl]methanamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.17 |
|---|
| Boiling Point | 53-55ºC(0.1mmHg) |
|---|
| Molecular Formula | C8H24N4Sn |
|---|
| Molecular Weight | 295.00400 |
|---|
| Flash Point | -8ºC |
|---|
| Exact Mass | 296.10200 |
|---|
| LogP | 2.09800 |
|---|
| Appearance of Characters | liquid | colorless to pale-yellow |
|---|
| Vapour Pressure | 1520mmHg at 25°C |
|---|
| InChIKey | WHXTVQNIFGXMSB-UHFFFAOYSA-N |
|---|
| SMILES | CN(C)[Sn](N(C)C)(N(C)C)N(C)C |
|---|
Safety Information
| Symbol | GHS02, GHS05, GHS07 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H225-H302 + H312 + H332-H314 |
|---|
| Precautionary Statements | P210-P280-P305 + P351 + P338-P310 |
|---|
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US) |
|---|
| Hazard Codes | F: Flammable;C: Corrosive; |
|---|
| Risk Phrases | R20/21/22;R34 |
|---|
| Safety Phrases | S16-S26-S36/37/39-S45 |
|---|
| RIDADR | UN 2924 |
|---|
Synonyms
| Octamethylstannanetetramine |
| Stannanetetramine,N,N,N',N',N'',N'',N''',N'''-octamethyl |
| MFCD00014860 |
| Stannanetetramine,octamethyl |