Introduction：Basic information about CAS 4147-32-4|Methyl 8-bromo-4,5,6-trimethoxy-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 8-bromo-4,5,6-trimethoxy-2-naphthoate |
|---|
| CAS Number | 4147-32-4 | Molecular Weight | 355.18100 |
|---|
| Density | 1.422g/cm3 | Boiling Point | 448.2ºC at 760 mmHg |
|---|
| Molecular Formula | C15H15BrO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 224.9ºC |
|---|
Names
| Name | Methyl 8-bromo-4,5,6-trimethoxy-2-naphthoate |
|---|
Chemical & Physical Properties
| Density | 1.422g/cm3 |
|---|
| Boiling Point | 448.2ºC at 760 mmHg |
|---|
| Molecular Formula | C15H15BrO5 |
|---|
| Molecular Weight | 355.18100 |
|---|
| Flash Point | 224.9ºC |
|---|
| Exact Mass | 354.01000 |
|---|
| PSA | 53.99000 |
|---|
| LogP | 3.41470 |
|---|
| Index of Refraction | 1.584 |
|---|
| InChIKey | QPEJEAJPJGLARX-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(OC)c2c(OC)c(OC)cc(Br)c2c1 |
|---|
