Introduction：Basic information about CAS 99660-52-3|Methyl 4-acetoxy-6-bromo-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 4-acetoxy-6-bromo-2-naphthoate |
|---|
| CAS Number | 99660-52-3 | Molecular Weight | 323.13900 |
|---|
| Density | 1.501g/cm3 | Boiling Point | 440.9ºC at 760 mmHg |
|---|
| Molecular Formula | C14H11BrO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 220.5ºC |
|---|
Names
| Name | Methyl 4-acetoxy-6-bromo-2-naphthoate |
|---|
Chemical & Physical Properties
| Density | 1.501g/cm3 |
|---|
| Boiling Point | 440.9ºC at 760 mmHg |
|---|
| Molecular Formula | C14H11BrO4 |
|---|
| Molecular Weight | 323.13900 |
|---|
| Flash Point | 220.5ºC |
|---|
| Exact Mass | 321.98400 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 3.31420 |
|---|
| Index of Refraction | 1.612 |
|---|
| InChIKey | KWOIAMUJKTZFCA-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(OC(C)=O)c2cc(Br)ccc2c1 |
|---|
