Introduction:Basic information about CAS 98941-60-7|Methyl 4,7-dihydroxy-5,6-dimethoxy-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 4,7-dihydroxy-5,6-dimethoxy-2-naphthoate |
|---|
| CAS Number | 98941-60-7 | Molecular Weight | 278.25700 |
|---|
| Density | 1.348g/cm3 | Boiling Point | 502.5ºC at 760 mmHg |
|---|
| Molecular Formula | C14H14O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 192.3ºC |
|---|
Names
| Name | Methyl 4,7-dihydroxy-5,6-dimethoxy-2-naphthoate |
|---|
Chemical & Physical Properties
| Density | 1.348g/cm3 |
|---|
| Boiling Point | 502.5ºC at 760 mmHg |
|---|
| Molecular Formula | C14H14O6 |
|---|
| Molecular Weight | 278.25700 |
|---|
| Flash Point | 192.3ºC |
|---|
| Exact Mass | 278.07900 |
|---|
| PSA | 85.22000 |
|---|
| LogP | 2.05480 |
|---|
| Index of Refraction | 1.625 |
|---|
| InChIKey | XPFUTFKDHUQOFU-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(O)c2c(OC)c(OC)c(O)cc2c1 |
|---|