Introduction:Basic information about CAS 104197-39-9|Methyl 4,6,7-trimethoxy-5-(methoxymethoxy)-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 4,6,7-trimethoxy-5-(methoxymethoxy)-2-naphthoate |
|---|
| CAS Number | 104197-39-9 | Molecular Weight | 336.33700 |
|---|
| Density | 1.199g/cm3 | Boiling Point | 466.2ºC at 760 mmHg |
|---|
| Molecular Formula | C17H20O7 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 205.3ºC |
|---|
Names
| Name | Methyl 4,6,7-trimethoxy-5-(methoxymethoxy)-2-naphthoate |
|---|
Chemical & Physical Properties
| Density | 1.199g/cm3 |
|---|
| Boiling Point | 466.2ºC at 760 mmHg |
|---|
| Molecular Formula | C17H20O7 |
|---|
| Molecular Weight | 336.33700 |
|---|
| Flash Point | 205.3ºC |
|---|
| Exact Mass | 336.12100 |
|---|
| PSA | 72.45000 |
|---|
| LogP | 2.63490 |
|---|
| Vapour Pressure | 7.23E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.547 |
|---|
| InChIKey | NHYIBAIDSJMZOW-UHFFFAOYSA-N |
|---|
| SMILES | COCOc1c(OC)c(OC)cc2cc(C(=O)OC)cc(OC)c12 |
|---|