Introduction:Basic information about CAS 105901-90-4|4,8-Dimethoxy-2-naphthoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,8-Dimethoxy-2-naphthoic acid |
|---|
| CAS Number | 105901-90-4 | Molecular Weight | 232.23200 |
|---|
| Density | 1.261g/cm3 | Boiling Point | 407.1ºC at 760 mmHg |
|---|
| Molecular Formula | C13H12O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 158.2ºC |
|---|
Names
| Name | 4,8-Dimethoxy-2-naphthoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.261g/cm3 |
|---|
| Boiling Point | 407.1ºC at 760 mmHg |
|---|
| Molecular Formula | C13H12O4 |
|---|
| Molecular Weight | 232.23200 |
|---|
| Flash Point | 158.2ºC |
|---|
| Exact Mass | 232.07400 |
|---|
| PSA | 55.76000 |
|---|
| LogP | 2.55520 |
|---|
| Vapour Pressure | 2.34E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.616 |
|---|
| InChIKey | VLSHUNALBMISTE-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(C(=O)O)cc2c(OC)cccc12 |
|---|
Synonyms
| 4,8-dimethoxynaphth-1-ol |
| 4,8-dimethoxy-1-naphthalenol |
| 1-Naphthalenol,4,8-dimethoxy |