Introduction:Basic information about CAS 107777-62-8|4,6,7-Trimethoxy-2-naphthoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,6,7-Trimethoxy-2-naphthoic acid |
|---|
| CAS Number | 107777-62-8 | Molecular Weight | 262.25800 |
|---|
| Density | / | Boiling Point | 426.1ºC at 760 mmHg |
|---|
| Molecular Formula | C14H14O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 161.2ºC |
|---|
Names
| Name | 4,6,7-Trimethoxy-2-naphthoic acid |
|---|
Chemical & Physical Properties
| Boiling Point | 426.1ºC at 760 mmHg |
|---|
| Molecular Formula | C14H14O5 |
|---|
| Molecular Weight | 262.25800 |
|---|
| Flash Point | 161.2ºC |
|---|
| Exact Mass | 262.08400 |
|---|
| PSA | 64.99000 |
|---|
| LogP | 2.56380 |
|---|
| Vapour Pressure | 5.07E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.598 |
|---|
| InChIKey | GDRVRVMXVVEIEQ-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc2cc(C(=O)O)cc(OC)c2cc1OC |
|---|