Introduction：Basic information about CAS 147589-46-6|Ethyl 6-chloro-4-hydroxy-5,8-dimethoxy-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl 6-chloro-4-hydroxy-5,8-dimethoxy-2-naphthoate |
|---|
| CAS Number | 147589-46-6 | Molecular Weight | 310.73000 |
|---|
| Density | 1.315g/cm3 | Boiling Point | 498.149ºC at 760 mmHg |
|---|
| Molecular Formula | C15H15ClO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 255.072ºC |
|---|
Names
| Name | Ethyl 6-chloro-4-hydroxy-5,8-dimethoxy-2-naphthoate |
|---|
Chemical & Physical Properties
| Density | 1.315g/cm3 |
|---|
| Boiling Point | 498.149ºC at 760 mmHg |
|---|
| Molecular Formula | C15H15ClO5 |
|---|
| Molecular Weight | 310.73000 |
|---|
| Flash Point | 255.072ºC |
|---|
| Exact Mass | 310.06100 |
|---|
| PSA | 64.99000 |
|---|
| LogP | 3.39270 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.598 |
|---|
| InChIKey | AJGWUAPUTKJZAS-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cc(O)c2c(OC)c(Cl)cc(OC)c2c1 |
|---|
