Introduction：Basic information about CAS 151502-72-6|ethyl 4-acetyloxy-7-methoxynaphthalene-2-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl 4-acetyloxy-7-methoxynaphthalene-2-carboxylate |
|---|
| CAS Number | 151502-72-6 | Molecular Weight | 288.29500 |
|---|
| Density | 1.203g/cm3 | Boiling Point | 439.2ºC at 760 mmHg |
|---|
| Molecular Formula | C16H16O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 195.2ºC |
|---|
Names
| Name | ethyl 4-acetyloxy-7-methoxynaphthalene-2-carboxylate |
|---|
Chemical & Physical Properties
| Density | 1.203g/cm3 |
|---|
| Boiling Point | 439.2ºC at 760 mmHg |
|---|
| Molecular Formula | C16H16O5 |
|---|
| Molecular Weight | 288.29500 |
|---|
| Flash Point | 195.2ºC |
|---|
| Exact Mass | 288.10000 |
|---|
| PSA | 61.83000 |
|---|
| LogP | 2.95040 |
|---|
| Vapour Pressure | 6.5E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.569 |
|---|
| InChIKey | PQJKWNCYBPJAOY-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cc(OC(C)=O)c2ccc(OC)cc2c1 |
|---|
