Introduction:Basic information about CAS 500777-13-9|Ethyl 5,8-bis(benzyloxy)-4-hydroxy-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl 5,8-bis(benzyloxy)-4-hydroxy-2-naphthoate |
|---|
| CAS Number | 500777-13-9 | Molecular Weight | 428.47600 |
|---|
| Density | 1.239g/cm3 | Boiling Point | 639.165ºC at 760 mmHg |
|---|
| Molecular Formula | C27H24O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 217.366ºC |
|---|
Names
| Name | Ethyl 5,8-bis(benzyloxy)-4-hydroxy-2-naphthoate |
|---|
Chemical & Physical Properties
| Density | 1.239g/cm3 |
|---|
| Boiling Point | 639.165ºC at 760 mmHg |
|---|
| Molecular Formula | C27H24O5 |
|---|
| Molecular Weight | 428.47600 |
|---|
| Flash Point | 217.366ºC |
|---|
| Exact Mass | 428.16200 |
|---|
| PSA | 64.99000 |
|---|
| LogP | 5.88010 |
|---|
| Index of Refraction | 1.641 |
|---|
| InChIKey | PTRFPFQXSHLVBI-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cc(O)c2c(OCc3ccccc3)ccc(OCc3ccccc3)c2c1 |
|---|