Introduction：Basic information about CAS 596095-76-0|8-Bromo-4-hydroxy-5-methoxy-2-naphthoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 8-Bromo-4-hydroxy-5-methoxy-2-naphthoic acid |
|---|
| CAS Number | 596095-76-0 | Molecular Weight | 297.10100 |
|---|
| Density | 1.7g/cm3 | Boiling Point | 492.3ºC at 760 mmHg |
|---|
| Molecular Formula | C12H9BrO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 251.6ºC |
|---|
Names
| Name | 8-Bromo-4-hydroxy-5-methoxy-2-naphthoic acid |
|---|
Chemical & Physical Properties
| Density | 1.7g/cm3 |
|---|
| Boiling Point | 492.3ºC at 760 mmHg |
|---|
| Molecular Formula | C12H9BrO4 |
|---|
| Molecular Weight | 297.10100 |
|---|
| Flash Point | 251.6ºC |
|---|
| Exact Mass | 295.96800 |
|---|
| PSA | 66.76000 |
|---|
| LogP | 3.01470 |
|---|
| Index of Refraction | 1.696 |
|---|
| InChIKey | OHROTZCNXIMLIU-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(Br)c2cc(C(=O)O)cc(O)c12 |
|---|
