Introduction：Basic information about CAS 693784-40-6|Ethyl 4-acetoxy-5-(benzyloxy)-7,8-dimethoxy-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl 4-acetoxy-5-(benzyloxy)-7,8-dimethoxy-2-naphthoate |
|---|
| CAS Number | 693784-40-6 | Molecular Weight | 424.44300 |
|---|
| Density | 1.218g/cm3 | Boiling Point | 585.6ºC at 760 mmHg |
|---|
| Molecular Formula | C24H24O7 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 253ºC |
|---|
Names
| Name | Ethyl 4-acetoxy-5-(benzyloxy)-7,8-dimethoxy-2-naphthoate |
|---|
Chemical & Physical Properties
| Density | 1.218g/cm3 |
|---|
| Boiling Point | 585.6ºC at 760 mmHg |
|---|
| Molecular Formula | C24H24O7 |
|---|
| Molecular Weight | 424.44300 |
|---|
| Flash Point | 253ºC |
|---|
| Exact Mass | 424.15200 |
|---|
| PSA | 80.29000 |
|---|
| LogP | 4.53800 |
|---|
| Index of Refraction | 1.582 |
|---|
| InChIKey | VDTRLKUNYIYDKF-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cc(OC(C)=O)c2c(OCc3ccccc3)cc(OC)c(OC)c2c1 |
|---|
