Introduction：Basic information about CAS 894779-44-3|Ethyl 4-{[dimethyl(2-methyl-2-propanyl)silyl]oxy}-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl 4-{[dimethyl(2-methyl-2-propanyl)silyl]oxy}-2-naphthoate |
|---|
| CAS Number | 894779-44-3 | Molecular Weight | 330.49300 |
|---|
| Density | 1.031g/cm3 | Boiling Point | 397.3ºC at 760 mmHg |
|---|
| Molecular Formula | C19H26O3Si | Melting Point | / |
|---|
| MSDS | / | Flash Point | 161.2ºC |
|---|
Names
| Name | Ethyl 4-{[dimethyl(2-methyl-2-propanyl)silyl]oxy}-2-naphthoate |
|---|
Chemical & Physical Properties
| Density | 1.031g/cm3 |
|---|
| Boiling Point | 397.3ºC at 760 mmHg |
|---|
| Molecular Formula | C19H26O3Si |
|---|
| Molecular Weight | 330.49300 |
|---|
| Flash Point | 161.2ºC |
|---|
| Exact Mass | 330.16500 |
|---|
| PSA | 35.53000 |
|---|
| LogP | 5.40050 |
|---|
| Index of Refraction | 1.53 |
|---|
| InChIKey | RKLGCMQMOAJFPQ-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cc(O[Si](C)(C)C(C)(C)C)c2ccccc2c1 |
|---|
