Introduction：Basic information about CAS 6297-11-6|2,7-Dichloro-9-fluorenone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,7-Dichloro-9-fluorenone |
|---|
| CAS Number | 6297-11-6 | Molecular Weight | 249.09200 |
|---|
| Density | 1.476g/cm3 | Boiling Point | 420.2ºC at 760 mmHg |
|---|
| Molecular Formula | C13H6Cl2O | Melting Point | 192-194ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 177.4ºC |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 2,7-dichlorofluoren-9-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.476g/cm3 |
|---|
| Boiling Point | 420.2ºC at 760 mmHg |
|---|
| Melting Point | 192-194ºC |
|---|
| Molecular Formula | C13H6Cl2O |
|---|
| Molecular Weight | 249.09200 |
|---|
| Flash Point | 177.4ºC |
|---|
| Exact Mass | 247.98000 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 4.20480 |
|---|
| Index of Refraction | 1.679 |
|---|
| InChIKey | HEYWYQQFXVEUSH-UHFFFAOYSA-N |
|---|
| SMILES | O=C1c2cc(Cl)ccc2-c2ccc(Cl)cc21 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| 2,7-Dichlorfluorenon |
| 2,5-DIMETHYL-P-ANISALDEHYDE |
| 2,7-dichloro-fluoren-9-one |
| 2,7-Dichlor-fluoren-9-on |
| Fluoren-9-one,2,7-dichloro |
| 2,7-Dichloro-9-fluorenone |
| 2,7-Dichlorofluorenone |
| 9H-Fluoren-9-one,2,7-dichloro |
| 2,7-dichlorofluorenone-9 |
