Introduction：Basic information about CAS 170104-82-2|tert-butyl 4-(4-amino-2,6-difluorophenyl)piperazine-1-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tert-butyl 4-(4-amino-2,6-difluorophenyl)piperazine-1-carboxylate |
|---|
| CAS Number | 170104-82-2 | Molecular Weight | 313.34300 |
|---|
| Density | 1.25g/cm3 | Boiling Point | 433.2ºC at 760 mmHg |
|---|
| Molecular Formula | C15H21F2N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 215.8ºC |
|---|
Names
| Name | tert-butyl 4-(4-amino-2,6-difluorophenyl)piperazine-1-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.25g/cm3 |
|---|
| Boiling Point | 433.2ºC at 760 mmHg |
|---|
| Molecular Formula | C15H21F2N3O2 |
|---|
| Molecular Weight | 313.34300 |
|---|
| Flash Point | 215.8ºC |
|---|
| Exact Mass | 313.16000 |
|---|
| PSA | 58.80000 |
|---|
| LogP | 3.18820 |
|---|
| Vapour Pressure | 1.05E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.543 |
|---|
| InChIKey | SKNCMVAICXALKM-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1CCN(c2c(F)cc(N)cc2F)CC1 |
|---|
Synonyms
| 4-[4-(tert-Butoxycarbonyl)piperazin-1-yl]-3,5-difluoroaniline |
| 4-(4-Amino-2,6-difluorophenyl)piperazine,N1-BOC protected |
| 4-(4-amino-2,6-difluoro-phenyl)-piperazine-1-carboxylic acid tert-butyl ester |
| 4-(4-amino-2,6-difluorophenyl)piperazine-1-carboxcylic acid tert-butyl ester |
| tert-butyl 4-(4-amino-2,6-difluoro-phenyl)-piperazine-1-carboxylate |
