Introduction:Basic information about CAS 37894-46-5|etacelasil, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | etacelasil |
|---|
| CAS Number | 37894-46-5 | Molecular Weight | 316.85100 |
|---|
| Density | 1.072g/cm3 | Boiling Point | 316.3ºC at 760mmHg |
|---|
| Molecular Formula | C11H25ClO6Si | Melting Point | / |
|---|
| MSDS | / | Flash Point | 121ºC |
|---|
Names
| Name | etacelasil |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.072g/cm3 |
|---|
| Boiling Point | 316.3ºC at 760mmHg |
|---|
| Molecular Formula | C11H25ClO6Si |
|---|
| Molecular Weight | 316.85100 |
|---|
| Flash Point | 121ºC |
|---|
| Exact Mass | 316.11100 |
|---|
| PSA | 55.38000 |
|---|
| LogP | 1.15310 |
|---|
| Index of Refraction | 1.434 |
|---|
| InChIKey | SLZWEMYSYKOWCG-UHFFFAOYSA-N |
|---|
| SMILES | COCCO[Si](CCCl)(OCCOC)OCCOC |
|---|
Safety Information
| Hazard Codes | T: Toxic; |
|---|
| Risk Phrases | 61-22-48/22 |
|---|
| HS Code | 2931900090 |
|---|
Customs
| HS Code | 2931900090 |
|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 6-(2-chloroethyl)-6-(2-methoxyethoxy)-2,5,7,10-tetraoxa-6-silaundecane |
| 6-(2-Chloroethyl)-6-(2-methoxyethoxy)-2,5,7,10-tetraoxa-6-silaundecane |
| Etacelasil [BSI:ISO] |
| Silane,2-chloroethyltris(2-methoxyethoxy) |
| 2-chloroethyl-tris(2-methoxyethoxy)silane |
| Alsol |
| Etacelasil |
| Etacelsal |
| CGA |
| 2-Chloroethyltris(2-methoxyethoxy)silane |
| 2-chloroethyltris(2-methoxyethoxy)silane |
| 2-chloroethyl-tris(methyloxyethoxy) silane |
| EINECS 253-704-7 |