Introduction：Basic information about CAS 10457-66-6|geranylhydroquinone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | geranylhydroquinone |
|---|
| CAS Number | 10457-66-6 | Molecular Weight | 246.34500 |
|---|
| Density | 1.035g/cm3 | Boiling Point | 413.1ºC at 760mmHg |
|---|
| Molecular Formula | C16H22O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 192.4ºC |
|---|
Names
| Name | geranylhydroquinone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.035g/cm3 |
|---|
| Boiling Point | 413.1ºC at 760mmHg |
|---|
| Molecular Formula | C16H22O2 |
|---|
| Molecular Weight | 246.34500 |
|---|
| Flash Point | 192.4ºC |
|---|
| Exact Mass | 246.16200 |
|---|
| PSA | 40.46000 |
|---|
| LogP | 4.33300 |
|---|
| Vapour Pressure | 2.06E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.555 |
|---|
| InChIKey | ZSCRTFONTNMQBL-NTUHNPAUSA-N |
|---|
| SMILES | CC(C)=CCCC(C)=CCc1cc(O)ccc1O |
|---|
Safety Information
Customs
| HS Code | 2907299090 |
|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
|---|
Synonyms
| Gerochinolo [DCIT] |
| Geroquinolum |
| Geroquinolum [INN-Latin] |
| geranyl-p-hydroquinone |
| 2-[(2E)-3,7-dimethylocta-2,6-dienyl]benzene-1,4-diol |
| Gerochinolo |
| 2-(2E)-(3,7-dimethyl-2,6-octadienyl)-1,4-benzenediol |
| 2-diprenyl-1,4-hydroquinone |
| 2-Geranylhydroquinone |
| (E)-2-(3,7,11-trimethyl-2,6,10-dodecatrienyl)hydroquinone |
| Geroquinol [INN:DCF] |
| (E)-2-(3,7-dimethylocta-2,6-dienyl)benzene-1,4-diol |
| geroquinol |
| Geranylhydroquinone |
