Introduction：Basic information about CAS 4327-84-8|N-Ethyl-N-(2-hydroxyethyl)-1,4-phenylenediamine sulfate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-Ethyl-N-(2-hydroxyethyl)-1,4-phenylenediamine sulfate |
|---|
| CAS Number | 4327-84-8 | Molecular Weight | 278.32500 |
|---|
| Density | / | Boiling Point | 344.7ºC at 760 mmHg |
|---|
| Molecular Formula | C10H18N2O5S | Melting Point | 177-179 °C (dec.) |
|---|
| MSDS | / | Flash Point | 162.3ºC |
|---|
Names
| Name | N-Ethyl-N-(2-hydroxyethyl)-1,4-phenylenediamine sulfate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 344.7ºC at 760 mmHg |
|---|
| Melting Point | 177-179 °C (dec.) |
|---|
| Molecular Formula | C10H18N2O5S |
|---|
| Molecular Weight | 278.32500 |
|---|
| Flash Point | 162.3ºC |
|---|
| Exact Mass | 278.09400 |
|---|
| PSA | 132.47000 |
|---|
| LogP | 2.09660 |
|---|
| InChIKey | KAJALVWKFPQZOO-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CCO)c1ccc(N)cc1.O=S(=O)(O)O |
|---|
Safety Information
| Hazard Codes | T |
|---|
| Risk Phrases | 25 |
|---|
| Safety Phrases | S22-S24/25 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2922199090 |
|---|
Customs
| HS Code | 2922199090 |
|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 2-(4-amino-N-ethylanilino)ethanol,sulfuric acid |
| EINECS 224-361-0 |
| 2-((4-Aminophenyl)(ethyl)amino)ethanol sulfate |
| N-Ethyl-N-(2-hydroxyethyl)-p-phenylenediamine sulfate |
| MFCD00040597 |
| N-Ethyl-N-(2-hydroxyethyl)-1,4-phenylenediamine Sulfate |
| 4-Amino-N-(2-hydroxyethyl)-N-ethylaniline Sulfate |
