Introduction：Basic information about CAS 3284-77-3|1-(dichloromethyl)-2-nitrobenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(dichloromethyl)-2-nitrobenzene |
|---|
| CAS Number | 3284-77-3 | Molecular Weight | 206.02600 |
|---|
| Density | 1.46g/cm3 | Boiling Point | 321.8ºC at 760mmHg |
|---|
| Molecular Formula | C7H5Cl2NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 148.4ºC |
|---|
Names
| Name | 1-(dichloromethyl)-2-nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.46g/cm3 |
|---|
| Boiling Point | 321.8ºC at 760mmHg |
|---|
| Molecular Formula | C7H5Cl2NO2 |
|---|
| Molecular Weight | 206.02600 |
|---|
| Flash Point | 148.4ºC |
|---|
| Exact Mass | 204.97000 |
|---|
| PSA | 45.82000 |
|---|
| LogP | 3.59420 |
|---|
| Index of Refraction | 1.586 |
|---|
| InChIKey | IREGSVSQCKFDNG-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccccc1C(Cl)Cl |
|---|
Safety Information
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| ortho-nitro(dichloromethyl)benzene |
| AC1Q3H2R |
| o-nitrobenzal chloride |
| 1-Dichlormethyl-2-nitro-benzol |
| AC1L2RNF |
| 1-dichloromethyl-2-nitro-benzene |
| EINECS 221-931-0 |
| KST-1B3282 |
| CTK4G9418 |
| AR-1B2883 |
| 2-nitrobenzylidene chloride |
| 2-nitro benzal chloride |
