Introduction：Basic information about CAS 5568-33-2|Benzaldehyde,2-chloro-4-nitro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzaldehyde,2-chloro-4-nitro- |
|---|
| CAS Number | 5568-33-2 | Molecular Weight | 185.56500 |
|---|
| Density | 1.485g/cm3 | Boiling Point | 312.4ºC at 760mmHg |
|---|
| Molecular Formula | C7H4ClNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 142.7ºC |
|---|
Names
| Name | 2-Chloro-4-nitrobenzaldehyde |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.485g/cm3 |
|---|
| Boiling Point | 312.4ºC at 760mmHg |
|---|
| Molecular Formula | C7H4ClNO3 |
|---|
| Molecular Weight | 185.56500 |
|---|
| Flash Point | 142.7ºC |
|---|
| Exact Mass | 184.98800 |
|---|
| PSA | 62.89000 |
|---|
| LogP | 2.58390 |
|---|
| Index of Refraction | 1.63 |
|---|
| InChIKey | GVBXZIANHMNKAK-UHFFFAOYSA-N |
|---|
| SMILES | O=Cc1ccc([N+](=O)[O-])cc1Cl |
|---|
Synonyms
| 2-Chlor-4-nitro-benzaldehyd |
| Benzaldehyde,2-chloro-4-nitro |
| 2-Chlor-5-nitrobenzaldehyd |
| 2-chloro-4-nitro-benzaldehyde |
