Introduction:Basic information about CAS 3365-90-0|4,4'-Diamino-3,3'-Biphenyldisulfonic Acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,4'-Diamino-3,3'-Biphenyldisulfonic Acid |
|---|
| CAS Number | 3365-90-0 | Molecular Weight | 344.36300 |
|---|
| Density | 1.681g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C12H12N2O6S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-amino-5-(4-amino-3-sulfophenyl)benzenesulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.681g/cm3 |
|---|
| Molecular Formula | C12H12N2O6S2 |
|---|
| Molecular Weight | 344.36300 |
|---|
| Exact Mass | 344.01400 |
|---|
| PSA | 177.54000 |
|---|
| LogP | 4.33540 |
|---|
| Index of Refraction | 1.702 |
|---|
| InChIKey | NFSOOPQRTBEFDR-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc(-c2ccc(N)c(S(=O)(=O)O)c2)cc1S(=O)(=O)O |
|---|
Safety Information
Customs
| HS Code | 2921590090 |
|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Benzidin-3.3'-disulfonsaeure |
| Benzidin-disulfonsaeure-(3.3') |
| 3,3'-Benzidinedisulfonic acid |
| 4,4'-Diamino-biphenyl-3,3'-disulfonsaeure |
| 4.4'-Diamino-diphenyl-disulfonsaeure-(3.3') |
| 3,4,4'-diamino |
| 4,4'-diaminobiphenyl-3,3'-disulphonic acid |
| 4,4'-diaminobiphenyl-3,3'-disulfonato |
| 4,3'-disulfonic acid |
| 4,4'diaminobiphenyl-3,3'-disulfonic acid |
| 4,4'-Diamino-3,3'-Biphenyldisulfonic Acid |