Introduction：Basic information about CAS 605-40-3|9,10-Anthracenedione,2,6-dichloro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 9,10-Anthracenedione,2,6-dichloro- |
|---|
| CAS Number | 605-40-3 | Molecular Weight | 277.10200 |
|---|
| Density | 1.514g/cm3 | Boiling Point | 455.2ºC at 760 mmHg |
|---|
| Molecular Formula | C14H6Cl2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 191.7ºC |
|---|
Names
| Name | 2,6-dichloroanthracene-9,10-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.514g/cm3 |
|---|
| Boiling Point | 455.2ºC at 760 mmHg |
|---|
| Molecular Formula | C14H6Cl2O2 |
|---|
| Molecular Weight | 277.10200 |
|---|
| Flash Point | 191.7ºC |
|---|
| Exact Mass | 275.97400 |
|---|
| PSA | 34.14000 |
|---|
| LogP | 3.76880 |
|---|
| Index of Refraction | 1.671 |
|---|
| InChIKey | KJGPMAHVCDFRBN-UHFFFAOYSA-N |
|---|
| SMILES | O=C1c2ccc(Cl)cc2C(=O)c2ccc(Cl)cc21 |
|---|
Synonyms
| 9,2,6-dichloro |
| Anthraquinone,2,6-dichloro |
| 2,6-dichloro-9,10-anthraquinone |
| 2,6-Dichlor-anthrachinon |
| 2,6-dichloro-9,10-anthracenedione |
| Anthraquinone,6-dichloro |
| 2,6-Dichloranthrachinon-(9,10) |
| 2,6-dichloro-anthraquinone |
