Introduction：Basic information about CAS 81-85-6|6-bromo-3-methyl-3H-dibenz[f,ij]isoquinoline-2,7-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-bromo-3-methyl-3H-dibenz[f,ij]isoquinoline-2,7-dione |
|---|
| CAS Number | 81-85-6 | Molecular Weight | 340.171 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 528.7±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H10BrNO2 | Melting Point | 273.6ºC |
|---|
| MSDS | / | Flash Point | 273.6±30.1 °C |
|---|
Names
| Name | 6-Bromo-3-methyl-3H-dibenz(f,ij)isoquinoline-2,7-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 528.7±50.0 °C at 760 mmHg |
|---|
| Melting Point | 273.6ºC |
|---|
| Molecular Formula | C17H10BrNO2 |
|---|
| Molecular Weight | 340.171 |
|---|
| Flash Point | 273.6±30.1 °C |
|---|
| Exact Mass | 338.989471 |
|---|
| PSA | 39.07000 |
|---|
| LogP | 1.98 |
|---|
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.757 |
|---|
| InChIKey | QTNAUUGQZYCWGQ-UHFFFAOYSA-N |
|---|
| SMILES | Cn1c(=O)cc2c3c(c(Br)ccc31)C(=O)c1ccccc1-2 |
|---|
Synonyms
| 4-bromo-1,9-N-methyl anthrapyridone |
| 6-Bromo-3-methyl-3H-dibenz(f,ij)isoquinoline-2,7-dione |
| 6-Bromo-3-methyl-3H-naphtho[1,2,3-de]quinoline-2,7-dione |
| 1'-Methyl-4-brom-anthrapyridon |
| 3H-Naphtho[1,2,3-de]quinoline-2,7-dione, 6-bromo-3-methyl- |
| 6-Brom-3-methyl-3H-naphtho[1,2,3-de]chinolin-2,7-dion |
| 3H-Dibenz(f,ij)isoquinoline-2,7-dione, 6-bromo-3-methyl- |
| 6-bromo-N-methylanthrapyridone |
