Introduction：Basic information about CAS 2826-28-0|Propanedinitrile,2-[[4-(dimethylamino)phenyl]methylene]-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Propanedinitrile,2-[[4-(dimethylamino)phenyl]methylene]- |
|---|
| CAS Number | 2826-28-0 | Molecular Weight | 197.23600 |
|---|
| Density | 1.15g/cm3 | Boiling Point | 370.4ºC at 760 mmHg |
|---|
| Molecular Formula | C12H11N3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 165.6ºC |
|---|
Names
| Name | 2-[[4-(dimethylamino)phenyl]methylidene]propanedinitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.15g/cm3 |
|---|
| Boiling Point | 370.4ºC at 760 mmHg |
|---|
| Molecular Formula | C12H11N3 |
|---|
| Molecular Weight | 197.23600 |
|---|
| Flash Point | 165.6ºC |
|---|
| Exact Mass | 197.09500 |
|---|
| PSA | 50.82000 |
|---|
| LogP | 2.18316 |
|---|
| Vapour Pressure | 1.11E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.626 |
|---|
| InChIKey | IYNONQVNLZATDK-UHFFFAOYSA-N |
|---|
| SMILES | CN(C)c1ccc(C=C(C#N)C#N)cc1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2926909090 |
|---|
Customs
| HS Code | 2926909090 |
|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| [4-(dimethylamino)phenyl]methylenepropanedinitrile |
| [4-(dimethylamino)benzylidene]propanedinitrile |
| 2-[(4-Dimethylaminophenyl)Methylidene]Propanedinitrile |
| 2-[4-(dimethylamino)phenyl]methylenemalononitrile |
| Benzene,1-dimethylamino-4-(2,2-dicyanoethenyl) |
| 2-(4-N,N-dimethylaminophenylmethylene)malononitrile |
| p-N,N-Dimethylaminobenzal malononitrile |
| 2-[[4-(dimethyamino)phenyl]methylene]propanedinitrile |
| 4--(N,N-Dimethylamino)benzalmalononitrile |
| 2-[4-(N,N-dimethylamino)benzylidene]malononitrile |
