Introduction：Basic information about CAS 321997-89-1|Methyl 4-amino-1-Boc-piperidine-4-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 4-amino-1-Boc-piperidine-4-carboxylate |
|---|
| CAS Number | 321997-89-1 | Molecular Weight | 258.31400 |
|---|
| Density | 1.131g/cm3 | Boiling Point | 333.6ºC at 760 mmHg |
|---|
| Molecular Formula | C12H22N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 155.6ºC |
|---|
Names
| Name | 1-O-tert-butyl 4-O-methyl 4-aminopiperidine-1,4-dicarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.131g/cm3 |
|---|
| Boiling Point | 333.6ºC at 760 mmHg |
|---|
| Molecular Formula | C12H22N2O4 |
|---|
| Molecular Weight | 258.31400 |
|---|
| Flash Point | 155.6ºC |
|---|
| Exact Mass | 258.15800 |
|---|
| PSA | 81.86000 |
|---|
| LogP | 1.52600 |
|---|
| Index of Refraction | 1.488 |
|---|
| InChIKey | MMPCQLBEECGPAP-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)C1(N)CCN(C(=O)OC(C)(C)C)CC1 |
|---|
Safety Information
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1-tert-Butyl 4-methyl 4-aminopiperidine-1,4-dicarboxylate |
| 1-(1,1-dimethylethyl) 4-methyl 4-amino-1,4-piperidinedicarboxylate |
| 1-t-butyl 4-methyl 4-aminopiperidine-1,4-dicarboxylate |
| Methyl 1-Boc-4-Aminopiperidine-4-carboxylate |
| 4,4-ACP(1-N-BOC)-OME |
| Methyl 4-Amino-1-Boc-piperidine-4-carboxylate |
| Methyl 4-amino-1-tert-butoxycarbonylpiperidine-4-carboxylate |
| 4-Amino-piperidine-1,4-dicarboxylic acid 1-tert-butyl ester 4-methyl ester |
| 1-BOC-4-Amino-piperidine-4-carboxylic acid methyl ester |
| methyl 1-BOC-4-amino-4-piperidinecarboxylate |
| 1,1-dimethylethyl 4-amino-4-methoxycarbonylpiperidine-1-carboxylate |
| Methyl1-Boc-4-Aminopiperidine-4-carboxylate |
