Introduction:Basic information about CAS 17096-07-0|3-(Methacryloyloxy)Propyl Tris(Trimethylsiloxy)Silane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(Methacryloyloxy)Propyl Tris(Trimethylsiloxy)Silane |
|---|
| CAS Number | 17096-07-0 | Molecular Weight | 422.812 |
|---|
| Density | 0.9±0.1 g/cm3 | Boiling Point | 368.6±44.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H38O5Si4 | Melting Point | <0ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 146.9±24.0 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 3-(Methacryloyloxy)Propyltris(Trimethylsiloxy)Silane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.9±0.1 g/cm3 |
|---|
| Boiling Point | 368.6±44.0 °C at 760 mmHg |
|---|
| Melting Point | <0ºC |
|---|
| Molecular Formula | C16H38O5Si4 |
|---|
| Molecular Weight | 422.812 |
|---|
| Flash Point | 146.9±24.0 °C |
|---|
| Exact Mass | 422.179626 |
|---|
| PSA | 53.99000 |
|---|
| LogP | 8.18 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.432 |
|---|
| InChIKey | BESKSSIEODQWBP-UHFFFAOYSA-N |
|---|
| SMILES | C=C(C)C(=O)OCCC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
|---|
| Storage condition | below 5° C |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| 3-{1,1,1,5,5,5-Hexamethyl-3-[(trimethylsilyl)oxy]-3-trisiloxanyl}propyl methacrylate |
| 3-(1,1,1,5,5,5-Hexamethyl-3-((trimethylsilyl)oxy)trisiloxan-3-yl)propyl methacrylate |
| 2-Propenoic acid, 2-methyl-, 3-[3,3,3-trimethyl-1,1-bis[(trimethylsilyl)oxy]disiloxanyl]propyl ester |
| 3-{1,1,1,5,5,5-Hexamethyl-3-[(trimethylsilyl)oxy]trisiloxan-3-yl}propyl methacrylate |
| MFCD00053871 |
| 3-(3,3,3-Trimethyl-1,1-bis((trimethylsilyl)oxy)disiloxanyl)propyl methacrylate |
| 3-(METHACRYLOYLOXY)PROPYLTRIS(TRIMETHYLSILOXY)SILANE |
| 3-[Tris(triMethylsilyloxy)silyl]propyl Methacrylate |
| (3-Methacryloyloxypropyl)tris(trimethylsiloxy)silane,Tris |
| Methacrylic Acid 3-[Tris(trimethylsilyloxy)silyl]propyl Ester |
| 3-[Tris(trimethylsiloxy)silyl]propyl methacrylate |
| EINECS 241-165-0 |
| 3-(Methacryloyloxy)propyltris(trimethylsilyloxy)silane |
| (3-Methacryloyloxypropyl)tris(trimethylsiloxy)silane |
| 3-(Methacryloyloxy)Propyl Tris(Trimethylsiloxy)Silane |