Introduction：Basic information about CAS 120-00-3|Azoic Diazo No.20, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Azoic Diazo No.20 |
|---|
| CAS Number | 120-00-3 | Molecular Weight | 300.352 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 405.5±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H20N2O3 | Melting Point | 98-100ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 199.0±28.7 °C |
|---|
| Symbol |
GHS05, GHS07 | Signal Word | Danger |
|---|
Names
| Name | N-(4-amino-2,5-diethoxyphenyl)benzamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 405.5±45.0 °C at 760 mmHg |
|---|
| Melting Point | 98-100ºC |
|---|
| Molecular Formula | C17H20N2O3 |
|---|
| Molecular Weight | 300.352 |
|---|
| Flash Point | 199.0±28.7 °C |
|---|
| Exact Mass | 300.147400 |
|---|
| PSA | 73.58000 |
|---|
| LogP | 2.33 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.614 |
|---|
| InChIKey | CNXZLZNEIYFZGU-UHFFFAOYSA-N |
|---|
| SMILES | CCOc1cc(NC(=O)c2ccccc2)c(OCC)cc1N |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Symbol |
GHS05, GHS07 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H315-H318-H335 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338 + P310 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|
| RIDADR | UN 1789 8 |
|---|
| WGK Germany | 1 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Blue 2B base* Blue Salt NBB |
| MFCD00009091 |
| Azoic Diazo No.20 |
| 2,5-diethoxy-4-benzoylamino-aniline |
| Fast Blue BBN |
| Blue Salt NBB |
| Fast Blue BB Base |
| EINECS 204-363-8 |
| 1-amino-2,5-diethoxy-4-benzoylaminobenzene |
| N-(4-Amino-2,5-diethoxyphenyl)benzamide |
| Fast blue BB |
| Azoic Diazo Component 20 (Base) |
| Benzamide, N-(4-amino-2,5-diethoxyphenyl)- |
| 2.5-Diaethoxy-N-benzoyl-p-phenylendiamin |
| 4'-Amino-2',5'-diethoxybenzanilide |
| Azoic Diazo Component 20 |
| Blue 2B base |
| 1-amino-4-benzoylamino-2,5-diethoxy-benzene |
| Stabamine Blue BB |
