Introduction：Basic information about CAS 62758-12-7|ethyl orange, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl orange |
|---|
| CAS Number | 62758-12-7 | Molecular Weight | 355.38700 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C16H18N3NaO3S | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | sodium,4-[[4-(diethylamino)phenyl]diazenyl]benzenesulfonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C16H18N3NaO3S |
|---|
| Molecular Weight | 355.38700 |
|---|
| Exact Mass | 355.09700 |
|---|
| PSA | 93.54000 |
|---|
| LogP | 4.93310 |
|---|
| InChIKey | YZORUOZKRBVLEG-UHFFFAOYSA-M |
|---|
| SMILES | CCN(CC)c1ccc(N=Nc2ccc(S(=O)(=O)[O-])cc2)cc1.[Na+] |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| Ethyl Orange sodium salt |
| MFCD00007503 |
| ethylorange |
| EINECS 263-716-4 |
