Introduction：Basic information about CAS 2484-88-0|Benzenesulfonic acid,4-(2-phenyldiazenyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenesulfonic acid,4-(2-phenyldiazenyl)- |
|---|
| CAS Number | 2484-88-0 | Molecular Weight | 262.28400 |
|---|
| Density | 1.33g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C12H10N2O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | p-azobenzenesulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.33g/cm3 |
|---|
| Molecular Formula | C12H10N2O3S |
|---|
| Molecular Weight | 262.28400 |
|---|
| Exact Mass | 262.04100 |
|---|
| PSA | 87.47000 |
|---|
| LogP | 4.42950 |
|---|
| Index of Refraction | 1.627 |
|---|
| InChIKey | AJMNDPOSKIBVGX-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(O)c1ccc(N=Nc2ccccc2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2927000090 |
|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Azobenzene-4-sulfonic acid |
| p-Phenylazobenzosulfonsaeure |
| 4-phenyldiazenylbenzenesulfonic acid |
| 4-phenylazo-benzenesulfonic acid |
| Azobenzol-4-sulfonsaeure |
| Azobenzene-4-sulphonic acid |
| 4-Phenylazo-benzolsulfonsaeure |
| 4-Sulfo-azobenzol |
